C20H23N3O2 — CID 135668912
1-butyl-5-[(2,5-dimethylphenyl)iminomethyl]-6-hydroxy-4-methyl-2-oxopyridine-3-carbonitrile (PubChem CID 135668912) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is 1-butyl-5-[(2,5-dimethylphenyl)iminomethyl]-6-hydroxy-4-methyl-2-oxopyridine-3-carbonitrile.
| Compound Name | 1-butyl-5-[(2,5-dimethylphenyl)iminomethyl]-6-hydroxy-4-methyl-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 135668912 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 1-butyl-5-[(2,5-dimethylphenyl)iminomethyl]-6-hydroxy-4-methyl-2-oxopyridine-3-carbonitrile |
| SMILES | CCCCn1c(O)c(/C=N/c2cc(C)ccc2C)c(C)c(C#N)c1=O |
| InChI | InChI=1S/C20H23N3O2/c1-5-6-9-23-19(24)16(11-21)15(4)17(20(23)25)12-22-18-10-13(2)7-8-14(18)3/h7-8,10,12,25H,5-6,9H2,1-4H3/b22-12+ |
| InChIKey | OPMXYVAKCKQTEK-WSDLNYQXSA-N |
| XLogP | 3.90 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|