C20H21Cl2N3O2 — CID 135668430
5-[(2,3-dichlorophenyl)iminomethyl]-1-hexyl-6-hydroxy-4-methyl-2-oxopyridine-3-carbonitrile (PubChem CID 135668430) has the molecular formula C20H21Cl2N3O2 and a molecular weight of 406.31 g/mol. Its IUPAC name is 5-[(2,3-dichlorophenyl)iminomethyl]-1-hexyl-6-hydroxy-4-methyl-2-oxopyridine-3-carbonitrile.
| Compound Name | 5-[(2,3-dichlorophenyl)iminomethyl]-1-hexyl-6-hydroxy-4-methyl-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 135668430 |
| Molecular Formula | C20H21Cl2N3O2 |
| Molecular Weight | 406.31 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | 5-[(2,3-dichlorophenyl)iminomethyl]-1-hexyl-6-hydroxy-4-methyl-2-oxopyridine-3-carbonitrile |
| SMILES | CCCCCCn1c(O)c(/C=N/c2cccc(Cl)c2Cl)c(C)c(C#N)c1=O |
| InChI | InChI=1S/C20H21Cl2N3O2/c1-3-4-5-6-10-25-19(26)14(11-23)13(2)15(20(25)27)12-24-17-9-7-8-16(21)18(17)22/h7-9,12,27H,3-6,10H2,1-2H3/b24-12+ |
| InChIKey | ZREYCYPDANIRPY-WYMPLXKRSA-N |
| XLogP | 5.37 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.31 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|