C23H27N3O4 — CID 135668980
ethyl 4-[(5-cyano-1-hexyl-2-hydroxy-4-methyl-6-oxo-3-pyridinyl)methylideneamino]benzoate (PubChem CID 135668980) has the molecular formula C23H27N3O4 and a molecular weight of 409.49 g/mol. Its IUPAC name is ethyl 4-[(5-cyano-1-hexyl-2-hydroxy-4-methyl-6-oxo-3-pyridinyl)methylideneamino]benzoate.
| Compound Name | ethyl 4-[(5-cyano-1-hexyl-2-hydroxy-4-methyl-6-oxo-3-pyridinyl)methylideneamino]benzoate |
|---|---|
| PubChem CID | 135668980 |
| Molecular Formula | C23H27N3O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | ethyl 4-[(5-cyano-1-hexyl-2-hydroxy-4-methyl-6-oxo-3-pyridinyl)methylideneamino]benzoate |
| SMILES | CCCCCCn1c(O)c(/C=N/c2ccc(C(=O)OCC)cc2)c(C)c(C#N)c1=O |
| InChI | InChI=1S/C23H27N3O4/c1-4-6-7-8-13-26-21(27)19(14-24)16(3)20(22(26)28)15-25-18-11-9-17(10-12-18)23(29)30-5-2/h9-12,15,28H,4-8,13H2,1-3H3/b25-15+ |
| InChIKey | HKBPDWKXLQVXQI-MFKUBSTISA-N |
| XLogP | 4.24 |
| TPSA | 104.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|