C18H16Br2N4O4 — CID 135669290
1-butyl-5-[(2,6-dibromo-4-nitrophenyl)iminomethyl]-6-hydroxy-4-methyl-2-oxopyridine-3-carbonitrile (PubChem CID 135669290) has the molecular formula C18H16Br2N4O4 and a molecular weight of 512.16 g/mol. Its IUPAC name is 1-butyl-5-[(2,6-dibromo-4-nitrophenyl)iminomethyl]-6-hydroxy-4-methyl-2-oxopyridine-3-carbonitrile.
| Compound Name | 1-butyl-5-[(2,6-dibromo-4-nitrophenyl)iminomethyl]-6-hydroxy-4-methyl-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 135669290 |
| Molecular Formula | C18H16Br2N4O4 |
| Molecular Weight | 512.16 g/mol |
| Exact Mass | 509.95 |
| IUPAC Name | 1-butyl-5-[(2,6-dibromo-4-nitrophenyl)iminomethyl]-6-hydroxy-4-methyl-2-oxopyridine-3-carbonitrile |
| SMILES | CCCCn1c(O)c(/C=N/c2c(Br)cc([N+](=O)[O-])cc2Br)c(C)c(C#N)c1=O |
| InChI | InChI=1S/C18H16Br2N4O4/c1-3-4-5-23-17(25)12(8-21)10(2)13(18(23)26)9-22-16-14(19)6-11(24(27)28)7-15(16)20/h6-7,9,26H,3-5H2,1-2H3/b22-9+ |
| InChIKey | GAWVROCAVGBHTG-LSFURLLWSA-N |
| XLogP | 4.72 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.16 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|