C19H18Br2N4O4 — CID 135669291
5-[(2,6-dibromo-4-nitrophenyl)iminomethyl]-6-hydroxy-4-methyl-2-oxo-1-pentylpyridine-3-carbonitrile (PubChem CID 135669291) has the molecular formula C19H18Br2N4O4 and a molecular weight of 526.19 g/mol. Its IUPAC name is 5-[(2,6-dibromo-4-nitrophenyl)iminomethyl]-6-hydroxy-4-methyl-2-oxo-1-pentylpyridine-3-carbonitrile.
| Compound Name | 5-[(2,6-dibromo-4-nitrophenyl)iminomethyl]-6-hydroxy-4-methyl-2-oxo-1-pentylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 135669291 |
| Molecular Formula | C19H18Br2N4O4 |
| Molecular Weight | 526.19 g/mol |
| Exact Mass | 523.97 |
| IUPAC Name | 5-[(2,6-dibromo-4-nitrophenyl)iminomethyl]-6-hydroxy-4-methyl-2-oxo-1-pentylpyridine-3-carbonitrile |
| SMILES | CCCCCn1c(O)c(/C=N/c2c(Br)cc([N+](=O)[O-])cc2Br)c(C)c(C#N)c1=O |
| InChI | InChI=1S/C19H18Br2N4O4/c1-3-4-5-6-24-18(26)13(9-22)11(2)14(19(24)27)10-23-17-15(20)7-12(25(28)29)8-16(17)21/h7-8,10,27H,3-6H2,1-2H3/b23-10+ |
| InChIKey | VHWLAWUSYNKISI-AUEPDCJTSA-N |
| XLogP | 5.11 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.19 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|