C15H11BrN4O4 — CID 135668575
5-[(2-bromo-4-nitrophenyl)iminomethyl]-6-hydroxy-1,4-dimethyl-2-oxopyridine-3-carbonitrile (PubChem CID 135668575) has the molecular formula C15H11BrN4O4 and a molecular weight of 391.18 g/mol. Its IUPAC name is 5-[(2-bromo-4-nitrophenyl)iminomethyl]-6-hydroxy-1,4-dimethyl-2-oxopyridine-3-carbonitrile.
| Compound Name | 5-[(2-bromo-4-nitrophenyl)iminomethyl]-6-hydroxy-1,4-dimethyl-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 135668575 |
| Molecular Formula | C15H11BrN4O4 |
| Molecular Weight | 391.18 g/mol |
| Exact Mass | 390.00 |
| IUPAC Name | 5-[(2-bromo-4-nitrophenyl)iminomethyl]-6-hydroxy-1,4-dimethyl-2-oxopyridine-3-carbonitrile |
| SMILES | Cc1c(/C=N/c2ccc([N+](=O)[O-])cc2Br)c(O)n(C)c(=O)c1C#N |
| InChI | InChI=1S/C15H11BrN4O4/c1-8-10(6-17)14(21)19(2)15(22)11(8)7-18-13-4-3-9(20(23)24)5-12(13)16/h3-5,7,22H,1-2H3/b18-7+ |
| InChIKey | KTJAEGVBECDMQG-CNHKJKLMSA-N |
| XLogP | 2.69 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.18 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|