C22H17BrN4O4 — CID 135668594
5-[(2-bromo-4-nitrophenyl)iminomethyl]-6-hydroxy-4-methyl-2-oxo-1-(2-phenylethyl)pyridine-3-carbonitrile (PubChem CID 135668594) has the molecular formula C22H17BrN4O4 and a molecular weight of 481.31 g/mol. Its IUPAC name is 5-[(2-bromo-4-nitrophenyl)iminomethyl]-6-hydroxy-4-methyl-2-oxo-1-(2-phenylethyl)pyridine-3-carbonitrile.
| Compound Name | 5-[(2-bromo-4-nitrophenyl)iminomethyl]-6-hydroxy-4-methyl-2-oxo-1-(2-phenylethyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 135668594 |
| Molecular Formula | C22H17BrN4O4 |
| Molecular Weight | 481.31 g/mol |
| Exact Mass | 480.04 |
| IUPAC Name | 5-[(2-bromo-4-nitrophenyl)iminomethyl]-6-hydroxy-4-methyl-2-oxo-1-(2-phenylethyl)pyridine-3-carbonitrile |
| SMILES | Cc1c(/C=N/c2ccc([N+](=O)[O-])cc2Br)c(O)n(CCc2ccccc2)c(=O)c1C#N |
| InChI | InChI=1S/C22H17BrN4O4/c1-14-17(12-24)21(28)26(10-9-15-5-3-2-4-6-15)22(29)18(14)13-25-20-8-7-16(27(30)31)11-19(20)23/h2-8,11,13,29H,9-10H2,1H3/b25-13+ |
| InChIKey | DOKOTCALJLPPNM-DHRITJCHSA-N |
| XLogP | 4.40 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.31 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|