C21H14Br2N4O4 — CID 135669304
1-benzyl-5-[(2,6-dibromo-4-nitrophenyl)iminomethyl]-6-hydroxy-4-methyl-2-oxopyridine-3-carbonitrile (PubChem CID 135669304) has the molecular formula C21H14Br2N4O4 and a molecular weight of 546.18 g/mol. Its IUPAC name is 1-benzyl-5-[(2,6-dibromo-4-nitrophenyl)iminomethyl]-6-hydroxy-4-methyl-2-oxopyridine-3-carbonitrile.
| Compound Name | 1-benzyl-5-[(2,6-dibromo-4-nitrophenyl)iminomethyl]-6-hydroxy-4-methyl-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 135669304 |
| Molecular Formula | C21H14Br2N4O4 |
| Molecular Weight | 546.18 g/mol |
| Exact Mass | 543.94 |
| IUPAC Name | 1-benzyl-5-[(2,6-dibromo-4-nitrophenyl)iminomethyl]-6-hydroxy-4-methyl-2-oxopyridine-3-carbonitrile |
| SMILES | Cc1c(/C=N/c2c(Br)cc([N+](=O)[O-])cc2Br)c(O)n(Cc2ccccc2)c(=O)c1C#N |
| InChI | InChI=1S/C21H14Br2N4O4/c1-12-15(9-24)20(28)26(11-13-5-3-2-4-6-13)21(29)16(12)10-25-19-17(22)7-14(27(30)31)8-18(19)23/h2-8,10,29H,11H2,1H3/b25-10+ |
| InChIKey | IRJBSWXCZBKZQK-KIBLKLHPSA-N |
| XLogP | 4.97 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.18 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|