C20H14ClN5O4 — CID 135669178
5-[(2-chloro-4-nitrophenyl)iminomethyl]-6-hydroxy-4-methyl-2-oxo-1-(pyridin-3-ylmethyl)pyridine-3-carbonitrile (PubChem CID 135669178) has the molecular formula C20H14ClN5O4 and a molecular weight of 423.82 g/mol. Its IUPAC name is 5-[(2-chloro-4-nitrophenyl)iminomethyl]-6-hydroxy-4-methyl-2-oxo-1-(pyridin-3-ylmethyl)pyridine-3-carbonitrile.
| Compound Name | 5-[(2-chloro-4-nitrophenyl)iminomethyl]-6-hydroxy-4-methyl-2-oxo-1-(pyridin-3-ylmethyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 135669178 |
| Molecular Formula | C20H14ClN5O4 |
| Molecular Weight | 423.82 g/mol |
| Exact Mass | 423.07 |
| IUPAC Name | 5-[(2-chloro-4-nitrophenyl)iminomethyl]-6-hydroxy-4-methyl-2-oxo-1-(pyridin-3-ylmethyl)pyridine-3-carbonitrile |
| SMILES | Cc1c(/C=N/c2ccc([N+](=O)[O-])cc2Cl)c(O)n(Cc2cccnc2)c(=O)c1C#N |
| InChI | InChI=1S/C20H14ClN5O4/c1-12-15(8-22)19(27)25(11-13-3-2-6-23-9-13)20(28)16(12)10-24-18-5-4-14(26(29)30)7-17(18)21/h2-7,9-10,28H,11H2,1H3/b24-10+ |
| InChIKey | MSVNBQBLGMIPCE-YSURURNPSA-N |
| XLogP | 3.49 |
| TPSA | 134.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.82 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|