C20H15N5O4 — CID 135668361
6-hydroxy-4-methyl-5-[(3-nitrophenyl)iminomethyl]-2-oxo-1-(pyridin-3-ylmethyl)pyridine-3-carbonitrile (PubChem CID 135668361) has the molecular formula C20H15N5O4 and a molecular weight of 389.37 g/mol. Its IUPAC name is 6-hydroxy-4-methyl-5-[(3-nitrophenyl)iminomethyl]-2-oxo-1-(pyridin-3-ylmethyl)pyridine-3-carbonitrile.
| Compound Name | 6-hydroxy-4-methyl-5-[(3-nitrophenyl)iminomethyl]-2-oxo-1-(pyridin-3-ylmethyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 135668361 |
| Molecular Formula | C20H15N5O4 |
| Molecular Weight | 389.37 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | 6-hydroxy-4-methyl-5-[(3-nitrophenyl)iminomethyl]-2-oxo-1-(pyridin-3-ylmethyl)pyridine-3-carbonitrile |
| SMILES | Cc1c(/C=N/c2cccc([N+](=O)[O-])c2)c(O)n(Cc2cccnc2)c(=O)c1C#N |
| InChI | InChI=1S/C20H15N5O4/c1-13-17(9-21)19(26)24(12-14-4-3-7-22-10-14)20(27)18(13)11-23-15-5-2-6-16(8-15)25(28)29/h2-8,10-11,27H,12H2,1H3/b23-11+ |
| InChIKey | VRSYTNICSZDKOX-FOKLQQMPSA-N |
| XLogP | 2.84 |
| TPSA | 134.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.37 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|