C17H15BrN4O4 — CID 135668577
5-[(2-bromo-4-nitrophenyl)iminomethyl]-6-hydroxy-4-methyl-2-oxo-1-propylpyridine-3-carbonitrile (PubChem CID 135668577) has the molecular formula C17H15BrN4O4 and a molecular weight of 419.24 g/mol. Its IUPAC name is 5-[(2-bromo-4-nitrophenyl)iminomethyl]-6-hydroxy-4-methyl-2-oxo-1-propylpyridine-3-carbonitrile.
| Compound Name | 5-[(2-bromo-4-nitrophenyl)iminomethyl]-6-hydroxy-4-methyl-2-oxo-1-propylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 135668577 |
| Molecular Formula | C17H15BrN4O4 |
| Molecular Weight | 419.24 g/mol |
| Exact Mass | 418.03 |
| IUPAC Name | 5-[(2-bromo-4-nitrophenyl)iminomethyl]-6-hydroxy-4-methyl-2-oxo-1-propylpyridine-3-carbonitrile |
| SMILES | CCCn1c(O)c(/C=N/c2ccc([N+](=O)[O-])cc2Br)c(C)c(C#N)c1=O |
| InChI | InChI=1S/C17H15BrN4O4/c1-3-6-21-16(23)12(8-19)10(2)13(17(21)24)9-20-15-5-4-11(22(25)26)7-14(15)18/h4-5,7,9,24H,3,6H2,1-2H3/b20-9+ |
| InChIKey | IKYMTLBVYOLVMT-AWQFTUOYSA-N |
| XLogP | 3.57 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.24 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|