C16H13ClN4O4 — CID 135981147
methyl 2-chloro-5-[(5-cyano-6-hydroxy-1,4-dimethyl-2-oxo-3-pyridinyl)diazenyl]benzoate (PubChem CID 135981147) has the molecular formula C16H13ClN4O4 and a molecular weight of 360.76 g/mol. Its IUPAC name is methyl 2-chloro-5-[(5-cyano-6-hydroxy-1,4-dimethyl-2-oxo-3-pyridinyl)diazenyl]benzoate.
| Compound Name | methyl 2-chloro-5-[(5-cyano-6-hydroxy-1,4-dimethyl-2-oxo-3-pyridinyl)diazenyl]benzoate |
|---|---|
| PubChem CID | 135981147 |
| Molecular Formula | C16H13ClN4O4 |
| Molecular Weight | 360.76 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | methyl 2-chloro-5-[(5-cyano-6-hydroxy-1,4-dimethyl-2-oxo-3-pyridinyl)diazenyl]benzoate |
| SMILES | COC(=O)c1cc(/N=N/c2c(C)c(C#N)c(O)n(C)c2=O)ccc1Cl |
| InChI | InChI=1S/C16H13ClN4O4/c1-8-11(7-18)14(22)21(2)15(23)13(8)20-19-9-4-5-12(17)10(6-9)16(24)25-3/h4-6,22H,1-3H3/b20-19+ |
| InChIKey | BAQGHNOBLILRAL-FMQUCBEESA-N |
| XLogP | 3.13 |
| TPSA | 117.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.76 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|