C21H24Cl2N4O2 — CID 137162031
5-[(3,4-dichlorophenyl)diazenyl]-1-(2-ethylhexyl)-2-hydroxy-4-methyl-6-oxopyridine-3-carbonitrile (PubChem CID 137162031) has the molecular formula C21H24Cl2N4O2 and a molecular weight of 435.36 g/mol. Its IUPAC name is 5-[(3,4-dichlorophenyl)diazenyl]-1-(2-ethylhexyl)-2-hydroxy-4-methyl-6-oxopyridine-3-carbonitrile.
| Compound Name | 5-[(3,4-dichlorophenyl)diazenyl]-1-(2-ethylhexyl)-2-hydroxy-4-methyl-6-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 137162031 |
| Molecular Formula | C21H24Cl2N4O2 |
| Molecular Weight | 435.36 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | 5-[(3,4-dichlorophenyl)diazenyl]-1-(2-ethylhexyl)-2-hydroxy-4-methyl-6-oxopyridine-3-carbonitrile |
| SMILES | CCCCC(CC)Cn1c(O)c(C#N)c(C)c(/N=N/c2ccc(Cl)c(Cl)c2)c1=O |
| InChI | InChI=1S/C21H24Cl2N4O2/c1-4-6-7-14(5-2)12-27-20(28)16(11-24)13(3)19(21(27)29)26-25-15-8-9-17(22)18(23)10-15/h8-10,14,28H,4-7,12H2,1-3H3/b26-25+ |
| InChIKey | OZNRZJRDMYGKOJ-OCEACIFDSA-N |
| XLogP | 6.67 |
| TPSA | 90.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.36 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|