C16H15BrN4O2 — CID 135835967
5-[(3-bromophenyl)diazenyl]-2-hydroxy-4-methyl-6-oxo-1-propylpyridine-3-carbonitrile (PubChem CID 135835967) has the molecular formula C16H15BrN4O2 and a molecular weight of 375.23 g/mol. Its IUPAC name is 5-[(3-bromophenyl)diazenyl]-2-hydroxy-4-methyl-6-oxo-1-propylpyridine-3-carbonitrile.
| Compound Name | 5-[(3-bromophenyl)diazenyl]-2-hydroxy-4-methyl-6-oxo-1-propylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 135835967 |
| Molecular Formula | C16H15BrN4O2 |
| Molecular Weight | 375.23 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | 5-[(3-bromophenyl)diazenyl]-2-hydroxy-4-methyl-6-oxo-1-propylpyridine-3-carbonitrile |
| SMILES | CCCn1c(O)c(C#N)c(C)c(/N=N/c2cccc(Br)c2)c1=O |
| InChI | InChI=1S/C16H15BrN4O2/c1-3-7-21-15(22)13(9-18)10(2)14(16(21)23)20-19-12-6-4-5-11(17)8-12/h4-6,8,22H,3,7H2,1-2H3/b20-19+ |
| InChIKey | YKXKMCPWJDHKGN-FMQUCBEESA-N |
| XLogP | 4.32 |
| TPSA | 90.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.23 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|