C21H17BrN6O4 — CID 136960637
7-bromo-6-[(5-cyano-6-hydroxy-4-methyl-2-oxo-1-propyl-3-pyridinyl)diazenyl]-2-ethyl-1,3-dioxoisoindole-5-carbonitrile (PubChem CID 136960637) has the molecular formula C21H17BrN6O4 and a molecular weight of 497.31 g/mol. Its IUPAC name is 7-bromo-6-[(5-cyano-6-hydroxy-4-methyl-2-oxo-1-propyl-3-pyridinyl)diazenyl]-2-ethyl-1,3-dioxoisoindole-5-carbonitrile.
| Compound Name | 7-bromo-6-[(5-cyano-6-hydroxy-4-methyl-2-oxo-1-propyl-3-pyridinyl)diazenyl]-2-ethyl-1,3-dioxoisoindole-5-carbonitrile |
|---|---|
| PubChem CID | 136960637 |
| Molecular Formula | C21H17BrN6O4 |
| Molecular Weight | 497.31 g/mol |
| Exact Mass | 496.05 |
| IUPAC Name | 7-bromo-6-[(5-cyano-6-hydroxy-4-methyl-2-oxo-1-propyl-3-pyridinyl)diazenyl]-2-ethyl-1,3-dioxoisoindole-5-carbonitrile |
| SMILES | CCCn1c(O)c(C#N)c(C)c(/N=N/c2c(C#N)cc3c(c2Br)C(=O)N(CC)C3=O)c1=O |
| InChI | InChI=1S/C21H17BrN6O4/c1-4-6-28-19(30)13(9-24)10(3)16(21(28)32)25-26-17-11(8-23)7-12-14(15(17)22)20(31)27(5-2)18(12)29/h7,30H,4-6H2,1-3H3/b26-25+ |
| InChIKey | SWPHXKMTJKTOOR-OCEACIFDSA-N |
| XLogP | 3.81 |
| TPSA | 151.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.31 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|