C24H23BrN6O4 — CID 136960641
7-bromo-6-[(5-cyano-1-hexyl-6-hydroxy-4-methyl-2-oxo-3-pyridinyl)diazenyl]-2-ethyl-1,3-dioxoisoindole-5-carbonitrile (PubChem CID 136960641) has the molecular formula C24H23BrN6O4 and a molecular weight of 539.39 g/mol. Its IUPAC name is 7-bromo-6-[(5-cyano-1-hexyl-6-hydroxy-4-methyl-2-oxo-3-pyridinyl)diazenyl]-2-ethyl-1,3-dioxoisoindole-5-carbonitrile.
| Compound Name | 7-bromo-6-[(5-cyano-1-hexyl-6-hydroxy-4-methyl-2-oxo-3-pyridinyl)diazenyl]-2-ethyl-1,3-dioxoisoindole-5-carbonitrile |
|---|---|
| PubChem CID | 136960641 |
| Molecular Formula | C24H23BrN6O4 |
| Molecular Weight | 539.39 g/mol |
| Exact Mass | 538.10 |
| IUPAC Name | 7-bromo-6-[(5-cyano-1-hexyl-6-hydroxy-4-methyl-2-oxo-3-pyridinyl)diazenyl]-2-ethyl-1,3-dioxoisoindole-5-carbonitrile |
| SMILES | CCCCCCn1c(O)c(C#N)c(C)c(/N=N/c2c(C#N)cc3c(c2Br)C(=O)N(CC)C3=O)c1=O |
| InChI | InChI=1S/C24H23BrN6O4/c1-4-6-7-8-9-31-22(33)16(12-27)13(3)19(24(31)35)28-29-20-14(11-26)10-15-17(18(20)25)23(34)30(5-2)21(15)32/h10,33H,4-9H2,1-3H3/b29-28+ |
| InChIKey | UMSJKHSHWDCGCM-ZQHSETAFSA-N |
| XLogP | 4.98 |
| TPSA | 151.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.39 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|