C23H15BrN4O5 — CID 136960645
methyl 4-[(4-bromo-6-cyano-2-ethyl-1,3-dioxoisoindol-5-yl)diazenyl]-3-hydroxynaphthalene-2-carboxylate (PubChem CID 136960645) has the molecular formula C23H15BrN4O5 and a molecular weight of 507.30 g/mol. Its IUPAC name is methyl 4-[(4-bromo-6-cyano-2-ethyl-1,3-dioxoisoindol-5-yl)diazenyl]-3-hydroxynaphthalene-2-carboxylate.
| Compound Name | methyl 4-[(4-bromo-6-cyano-2-ethyl-1,3-dioxoisoindol-5-yl)diazenyl]-3-hydroxynaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 136960645 |
| Molecular Formula | C23H15BrN4O5 |
| Molecular Weight | 507.30 g/mol |
| Exact Mass | 506.02 |
| IUPAC Name | methyl 4-[(4-bromo-6-cyano-2-ethyl-1,3-dioxoisoindol-5-yl)diazenyl]-3-hydroxynaphthalene-2-carboxylate |
| SMILES | CCN1C(=O)c2cc(C#N)c(/N=N/c3c(O)c(C(=O)OC)cc4ccccc34)c(Br)c2C1=O |
| InChI | InChI=1S/C23H15BrN4O5/c1-3-28-21(30)14-9-12(10-25)18(17(24)16(14)22(28)31)26-27-19-13-7-5-4-6-11(13)8-15(20(19)29)23(32)33-2/h4-9,29H,3H2,1-2H3/b27-26+ |
| InChIKey | PRIAHSMMILBDCN-CYYJNZCTSA-N |
| XLogP | 5.00 |
| TPSA | 132.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.30 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|