C28H20N4O6 — CID 136854397
ethyl 2-[[4-[(1,3-dioxoisoindol-5-yl)diazenyl]-3-hydroxynaphthalene-2-carbonyl]amino]benzoate (PubChem CID 136854397) has the molecular formula C28H20N4O6 and a molecular weight of 508.49 g/mol. Its IUPAC name is ethyl 2-[[4-[(1,3-dioxoisoindol-5-yl)diazenyl]-3-hydroxynaphthalene-2-carbonyl]amino]benzoate.
| Compound Name | ethyl 2-[[4-[(1,3-dioxoisoindol-5-yl)diazenyl]-3-hydroxynaphthalene-2-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 136854397 |
| Molecular Formula | C28H20N4O6 |
| Molecular Weight | 508.49 g/mol |
| Exact Mass | 508.14 |
| IUPAC Name | ethyl 2-[[4-[(1,3-dioxoisoindol-5-yl)diazenyl]-3-hydroxynaphthalene-2-carbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)c1cc2ccccc2c(/N=N/c2ccc3c(c2)C(=O)NC3=O)c1O |
| InChI | InChI=1S/C28H20N4O6/c1-2-38-28(37)19-9-5-6-10-22(19)29-27(36)21-13-15-7-3-4-8-17(15)23(24(21)33)32-31-16-11-12-18-20(14-16)26(35)30-25(18)34/h3-14,33H,2H2,1H3,(H,29,36)(H,30,34,35)/b32-31+ |
| InChIKey | VMBICUROOYDZEE-QNEJGDQOSA-N |
| XLogP | 5.27 |
| TPSA | 146.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.49 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|