C23H19N3O3 — CID 51046380
ethyl 2-[(3-naphthalen-1-yl-1H-pyrazole-5-carbonyl)amino]benzoate (PubChem CID 51046380) has the molecular formula C23H19N3O3 and a molecular weight of 385.42 g/mol. Its IUPAC name is ethyl 2-[(3-naphthalen-1-yl-1H-pyrazole-5-carbonyl)amino]benzoate.
| Compound Name | ethyl 2-[(3-naphthalen-1-yl-1H-pyrazole-5-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 51046380 |
| Molecular Formula | C23H19N3O3 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | ethyl 2-[(3-naphthalen-1-yl-1H-pyrazole-5-carbonyl)amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)c1cc(-c2cccc3ccccc23)n[nH]1 |
| InChI | InChI=1S/C23H19N3O3/c1-2-29-23(28)18-11-5-6-13-19(18)24-22(27)21-14-20(25-26-21)17-12-7-9-15-8-3-4-10-16(15)17/h3-14H,2H2,1H3,(H,24,27)(H,25,26) |
| InChIKey | NVZVVHWMUWDREU-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |