C18H14FN3O3 — CID 45030489
methyl 2-[[3-(4-fluorophenyl)-1H-pyrazole-5-carbonyl]amino]benzoate (PubChem CID 45030489) has the molecular formula C18H14FN3O3 and a molecular weight of 339.33 g/mol. Its IUPAC name is methyl 2-[[3-(4-fluorophenyl)-1H-pyrazole-5-carbonyl]amino]benzoate.
| Compound Name | methyl 2-[[3-(4-fluorophenyl)-1H-pyrazole-5-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 45030489 |
| Molecular Formula | C18H14FN3O3 |
| Molecular Weight | 339.33 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | methyl 2-[[3-(4-fluorophenyl)-1H-pyrazole-5-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)c1cc(-c2ccc(F)cc2)n[nH]1 |
| InChI | InChI=1S/C18H14FN3O3/c1-25-18(24)13-4-2-3-5-14(13)20-17(23)16-10-15(21-22-16)11-6-8-12(19)9-7-11/h2-10H,1H3,(H,20,23)(H,21,22) |
| InChIKey | IWJOEGBBSOWMIW-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.33 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |