C18H13FN2O4 — CID 3571866
methyl 2-[[5-(4-fluorophenyl)-1,2-oxazole-3-carbonyl]amino]benzoate (PubChem CID 3571866) has the molecular formula C18H13FN2O4 and a molecular weight of 340.31 g/mol. Its IUPAC name is methyl 2-[[5-(4-fluorophenyl)-1,2-oxazole-3-carbonyl]amino]benzoate.
| Compound Name | methyl 2-[[5-(4-fluorophenyl)-1,2-oxazole-3-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 3571866 |
| Molecular Formula | C18H13FN2O4 |
| Molecular Weight | 340.31 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | methyl 2-[[5-(4-fluorophenyl)-1,2-oxazole-3-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)c1cc(-c2ccc(F)cc2)on1 |
| InChI | InChI=1S/C18H13FN2O4/c1-24-18(23)13-4-2-3-5-14(13)20-17(22)15-10-16(25-21-15)11-6-8-12(19)9-7-11/h2-10H,1H3,(H,20,22) |
| InChIKey | PPIAISOIUYKTCK-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.31 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |