C21H16BrN3O — CID 51046417
N-(4-bromo-2-methylphenyl)-3-naphthalen-1-yl-1H-pyrazole-5-carboxamide (PubChem CID 51046417) has the molecular formula C21H16BrN3O and a molecular weight of 406.28 g/mol. Its IUPAC name is N-(4-bromo-2-methylphenyl)-3-naphthalen-1-yl-1H-pyrazole-5-carboxamide.
| Compound Name | N-(4-bromo-2-methylphenyl)-3-naphthalen-1-yl-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 51046417 |
| Molecular Formula | C21H16BrN3O |
| Molecular Weight | 406.28 g/mol |
| Exact Mass | 405.05 |
| IUPAC Name | N-(4-bromo-2-methylphenyl)-3-naphthalen-1-yl-1H-pyrazole-5-carboxamide |
| SMILES | Cc1cc(Br)ccc1NC(=O)c1cc(-c2cccc3ccccc23)n[nH]1 |
| InChI | InChI=1S/C21H16BrN3O/c1-13-11-15(22)9-10-18(13)23-21(26)20-12-19(24-25-20)17-8-4-6-14-5-2-3-7-16(14)17/h2-12H,1H3,(H,23,26)(H,24,25) |
| InChIKey | JSOGKHCTBAHMMA-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.28 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |