C24H20N2O3 — CID 139801143
ethyl 2-[[2-(2H-isoindol-1-yl)benzoyl]amino]benzoate (PubChem CID 139801143) has the molecular formula C24H20N2O3 and a molecular weight of 384.44 g/mol. Its IUPAC name is ethyl 2-[[2-(2H-isoindol-1-yl)benzoyl]amino]benzoate.
| Compound Name | ethyl 2-[[2-(2H-isoindol-1-yl)benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 139801143 |
| Molecular Formula | C24H20N2O3 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | ethyl 2-[[2-(2H-isoindol-1-yl)benzoyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)c1ccccc1-c1[nH]cc2ccccc12 |
| InChI | InChI=1S/C24H20N2O3/c1-2-29-24(28)20-13-7-8-14-21(20)26-23(27)19-12-6-5-11-18(19)22-17-10-4-3-9-16(17)15-25-22/h3-15,25H,2H2,1H3,(H,26,27) |
| InChIKey | DUYINUMLMVFZLB-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |