C21H18N2O4 — CID 110651274
ethyl 2-[(2-oxo-4-phenyl-1H-pyridine-3-carbonyl)amino]benzoate (PubChem CID 110651274) has the molecular formula C21H18N2O4 and a molecular weight of 362.39 g/mol. Its IUPAC name is ethyl 2-[(2-oxo-4-phenyl-1H-pyridine-3-carbonyl)amino]benzoate.
| Compound Name | ethyl 2-[(2-oxo-4-phenyl-1H-pyridine-3-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 110651274 |
| Molecular Formula | C21H18N2O4 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | ethyl 2-[(2-oxo-4-phenyl-1H-pyridine-3-carbonyl)amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)c1c(-c2ccccc2)cc[nH]c1=O |
| InChI | InChI=1S/C21H18N2O4/c1-2-27-21(26)16-10-6-7-11-17(16)23-20(25)18-15(12-13-22-19(18)24)14-8-4-3-5-9-14/h3-13H,2H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | TVMVMQBIVJJORS-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |