methyl 3-cyano-4-fluoronaphthalene-1-carboxylate

C13H8FNO2 — CID 11806440

IUPACmethyl 3-cyano-4-fluoronaphthalene-1-carboxylate
SMILESCOC(=O)c1cc(C#N)c(F)c2ccccc12
InChIInChI=1S/C13H8FNO2/c1-17-13(16)11-6-8(7-15)12(14)10-5-3-2-4-9(10)11/h2-6H,1H3
InChIKeyZNCIJBMXMSXPAQ-UHFFFAOYSA-N
MW229.21 g/mol
LogP2.64
Rot. Bonds1

About methyl 3-cyano-4-fluoronaphthalene-1-carboxylate

methyl 3-cyano-4-fluoronaphthalene-1-carboxylate (PubChem CID 11806440) has the molecular formula C13H8FNO2 and a molecular weight of 229.21 g/mol. Its IUPAC name is methyl 3-cyano-4-fluoronaphthalene-1-carboxylate.

Molecular Properties

Compound Namemethyl 3-cyano-4-fluoronaphthalene-1-carboxylate
PubChem CID11806440
Molecular FormulaC13H8FNO2
Molecular Weight229.21 g/mol
Exact Mass229.05
IUPAC Namemethyl 3-cyano-4-fluoronaphthalene-1-carboxylate
SMILESCOC(=O)c1cc(C#N)c(F)c2ccccc12
InChIInChI=1S/C13H8FNO2/c1-17-13(16)11-6-8(7-15)12(14)10-5-3-2-4-9(10)11/h2-6H,1H3
InChIKeyZNCIJBMXMSXPAQ-UHFFFAOYSA-N
XLogP2.64
TPSA50.09 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500229.21
LogP ≤ 52.64
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 3-cyano-4-fluoronaphthalene-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-cyano-4-fluoronaphthalene-1-carboxylate?
The IUPAC name of methyl 3-cyano-4-fluoronaphthalene-1-carboxylate (CID 11806440) is methyl 3-cyano-4-fluoronaphthalene-1-carboxylate.
What is the SMILES notation for methyl 3-cyano-4-fluoronaphthalene-1-carboxylate?
The canonical SMILES for methyl 3-cyano-4-fluoronaphthalene-1-carboxylate is COC(=O)c1cc(C#N)c(F)c2ccccc12.
What is the InChIKey of methyl 3-cyano-4-fluoronaphthalene-1-carboxylate?
The InChIKey is ZNCIJBMXMSXPAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8FNO2/c1-17-13(16)11-6-8(7-15)12(14)10-5-3-2-4-9(10)11/h2-6H,1H3.
What are the key properties of methyl 3-cyano-4-fluoronaphthalene-1-carboxylate?
methyl 3-cyano-4-fluoronaphthalene-1-carboxylate has a molecular weight of 229.21 g/mol, XLogP of 2.64, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-cyano-4-fluoronaphthalene-1-carboxylate is sourced from PubChem (CID 11806440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).