C17H10F5NO4 — CID 66717867
methyl 4-cyano-2,5-difluorobenzoate;methyl 2,4,5-trifluorobenzoate (PubChem CID 66717867) has the molecular formula C17H10F5NO4 and a molecular weight of 387.26 g/mol. Its IUPAC name is methyl 4-cyano-2,5-difluorobenzoate;methyl 2,4,5-trifluorobenzoate.
| Compound Name | methyl 4-cyano-2,5-difluorobenzoate;methyl 2,4,5-trifluorobenzoate |
|---|---|
| PubChem CID | 66717867 |
| Molecular Formula | C17H10F5NO4 |
| Molecular Weight | 387.26 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | methyl 4-cyano-2,5-difluorobenzoate;methyl 2,4,5-trifluorobenzoate |
| SMILES | COC(=O)c1cc(F)c(C#N)cc1F.COC(=O)c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C9H5F2NO2.C8H5F3O2/c1-14-9(13)6-3-7(10)5(4-12)2-8(6)11;1-13-8(12)4-2-6(10)7(11)3-5(4)9/h2-3H,1H3;2-3H,1H3 |
| InChIKey | LNPMYFIBMSAFPB-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.26 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|