C10H7F2NO2 — CID 86694454
methyl 2-(4-cyano-2,5-difluorophenyl)acetate (PubChem CID 86694454) has the molecular formula C10H7F2NO2 and a molecular weight of 211.17 g/mol. Its IUPAC name is methyl 2-(4-cyano-2,5-difluorophenyl)acetate.
| Compound Name | methyl 2-(4-cyano-2,5-difluorophenyl)acetate |
|---|---|
| PubChem CID | 86694454 |
| Molecular Formula | C10H7F2NO2 |
| Molecular Weight | 211.17 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | methyl 2-(4-cyano-2,5-difluorophenyl)acetate |
| SMILES | COC(=O)Cc1cc(F)c(C#N)cc1F |
| InChI | InChI=1S/C10H7F2NO2/c1-15-10(14)4-6-2-9(12)7(5-13)3-8(6)11/h2-3H,4H2,1H3 |
| InChIKey | XSKIEEKZDPELGD-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.17 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |