C20H15BrN6O5 — CID 137287296
7-bromo-6-[[5-cyano-6-hydroxy-1-(2-methoxyethyl)-4-methyl-2-oxo-3-pyridinyl]diazenyl]-2-methyl-1,3-dioxoisoindole-5-carbonitrile (PubChem CID 137287296) has the molecular formula C20H15BrN6O5 and a molecular weight of 499.28 g/mol. Its IUPAC name is 7-bromo-6-[[5-cyano-6-hydroxy-1-(2-methoxyethyl)-4-methyl-2-oxo-3-pyridinyl]diazenyl]-2-methyl-1,3-dioxoisoindole-5-carbonitrile.
| Compound Name | 7-bromo-6-[[5-cyano-6-hydroxy-1-(2-methoxyethyl)-4-methyl-2-oxo-3-pyridinyl]diazenyl]-2-methyl-1,3-dioxoisoindole-5-carbonitrile |
|---|---|
| PubChem CID | 137287296 |
| Molecular Formula | C20H15BrN6O5 |
| Molecular Weight | 499.28 g/mol |
| Exact Mass | 498.03 |
| IUPAC Name | 7-bromo-6-[[5-cyano-6-hydroxy-1-(2-methoxyethyl)-4-methyl-2-oxo-3-pyridinyl]diazenyl]-2-methyl-1,3-dioxoisoindole-5-carbonitrile |
| SMILES | COCCn1c(O)c(C#N)c(C)c(/N=N/c2c(C#N)cc3c(c2Br)C(=O)N(C)C3=O)c1=O |
| InChI | InChI=1S/C20H15BrN6O5/c1-9-12(8-23)18(29)27(4-5-32-3)20(31)15(9)24-25-16-10(7-22)6-11-13(14(16)21)19(30)26(2)17(11)28/h6,29H,4-5H2,1-3H3/b25-24+ |
| InChIKey | SNCFOGVLCOSCQJ-OCOZRVBESA-N |
| XLogP | 2.66 |
| TPSA | 161.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.28 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|