C16H14N6O7 — CID 135835241
5-[(2,4-dinitrophenyl)diazenyl]-2-hydroxy-1-(2-methoxyethyl)-4-methyl-6-oxopyridine-3-carbonitrile (PubChem CID 135835241) has the molecular formula C16H14N6O7 and a molecular weight of 402.32 g/mol. Its IUPAC name is 5-[(2,4-dinitrophenyl)diazenyl]-2-hydroxy-1-(2-methoxyethyl)-4-methyl-6-oxopyridine-3-carbonitrile.
| Compound Name | 5-[(2,4-dinitrophenyl)diazenyl]-2-hydroxy-1-(2-methoxyethyl)-4-methyl-6-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 135835241 |
| Molecular Formula | C16H14N6O7 |
| Molecular Weight | 402.32 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | 5-[(2,4-dinitrophenyl)diazenyl]-2-hydroxy-1-(2-methoxyethyl)-4-methyl-6-oxopyridine-3-carbonitrile |
| SMILES | COCCn1c(O)c(C#N)c(C)c(/N=N/c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c1=O |
| InChI | InChI=1S/C16H14N6O7/c1-9-11(8-17)15(23)20(5-6-29-2)16(24)14(9)19-18-12-4-3-10(21(25)26)7-13(12)22(27)28/h3-4,7,23H,5-6H2,1-2H3/b19-18+ |
| InChIKey | YJOKJXISCCKPSY-VHEBQXMUSA-N |
| XLogP | 2.61 |
| TPSA | 186.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.32 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|