C17H16N6O6 — CID 135835239
5-[(2,4-dinitrophenyl)diazenyl]-2-hydroxy-4-methyl-1-(2-methylpropyl)-6-oxopyridine-3-carbonitrile (PubChem CID 135835239) has the molecular formula C17H16N6O6 and a molecular weight of 400.35 g/mol. Its IUPAC name is 5-[(2,4-dinitrophenyl)diazenyl]-2-hydroxy-4-methyl-1-(2-methylpropyl)-6-oxopyridine-3-carbonitrile.
| Compound Name | 5-[(2,4-dinitrophenyl)diazenyl]-2-hydroxy-4-methyl-1-(2-methylpropyl)-6-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 135835239 |
| Molecular Formula | C17H16N6O6 |
| Molecular Weight | 400.35 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | 5-[(2,4-dinitrophenyl)diazenyl]-2-hydroxy-4-methyl-1-(2-methylpropyl)-6-oxopyridine-3-carbonitrile |
| SMILES | Cc1c(C#N)c(O)n(CC(C)C)c(=O)c1/N=N/c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H16N6O6/c1-9(2)8-21-16(24)12(7-18)10(3)15(17(21)25)20-19-13-5-4-11(22(26)27)6-14(13)23(28)29/h4-6,9,24H,8H2,1-3H3/b20-19+ |
| InChIKey | FTNBOFYGNVNFAC-FMQUCBEESA-N |
| XLogP | 3.62 |
| TPSA | 177.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.35 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|