C22H18ClN5O5 — CID 135835942
5-[(2-chloro-4-nitrophenyl)diazenyl]-2-hydroxy-1-[2-(4-methoxyphenyl)ethyl]-4-methyl-6-oxopyridine-3-carbonitrile (PubChem CID 135835942) has the molecular formula C22H18ClN5O5 and a molecular weight of 467.87 g/mol. Its IUPAC name is 5-[(2-chloro-4-nitrophenyl)diazenyl]-2-hydroxy-1-[2-(4-methoxyphenyl)ethyl]-4-methyl-6-oxopyridine-3-carbonitrile.
| Compound Name | 5-[(2-chloro-4-nitrophenyl)diazenyl]-2-hydroxy-1-[2-(4-methoxyphenyl)ethyl]-4-methyl-6-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 135835942 |
| Molecular Formula | C22H18ClN5O5 |
| Molecular Weight | 467.87 g/mol |
| Exact Mass | 467.10 |
| IUPAC Name | 5-[(2-chloro-4-nitrophenyl)diazenyl]-2-hydroxy-1-[2-(4-methoxyphenyl)ethyl]-4-methyl-6-oxopyridine-3-carbonitrile |
| SMILES | COc1ccc(CCn2c(O)c(C#N)c(C)c(/N=N/c3ccc([N+](=O)[O-])cc3Cl)c2=O)cc1 |
| InChI | InChI=1S/C22H18ClN5O5/c1-13-17(12-24)21(29)27(10-9-14-3-6-16(33-2)7-4-14)22(30)20(13)26-25-19-8-5-15(28(31)32)11-18(19)23/h3-8,11,29H,9-10H2,1-2H3/b26-25+ |
| InChIKey | LPSUTTOGOFVRHT-OCEACIFDSA-N |
| XLogP | 4.96 |
| TPSA | 143.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.87 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|