C21H16N6O6 — CID 135835249
5-[(2,4-dinitrophenyl)diazenyl]-2-hydroxy-4-methyl-6-oxo-1-(2-phenylethyl)pyridine-3-carbonitrile (PubChem CID 135835249) has the molecular formula C21H16N6O6 and a molecular weight of 448.40 g/mol. Its IUPAC name is 5-[(2,4-dinitrophenyl)diazenyl]-2-hydroxy-4-methyl-6-oxo-1-(2-phenylethyl)pyridine-3-carbonitrile.
| Compound Name | 5-[(2,4-dinitrophenyl)diazenyl]-2-hydroxy-4-methyl-6-oxo-1-(2-phenylethyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 135835249 |
| Molecular Formula | C21H16N6O6 |
| Molecular Weight | 448.40 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | 5-[(2,4-dinitrophenyl)diazenyl]-2-hydroxy-4-methyl-6-oxo-1-(2-phenylethyl)pyridine-3-carbonitrile |
| SMILES | Cc1c(C#N)c(O)n(CCc2ccccc2)c(=O)c1/N=N/c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H16N6O6/c1-13-16(12-22)20(28)25(10-9-14-5-3-2-4-6-14)21(29)19(13)24-23-17-8-7-15(26(30)31)11-18(17)27(32)33/h2-8,11,28H,9-10H2,1H3/b24-23+ |
| InChIKey | TUJJNROZQPYAPO-WCWDXBQESA-N |
| XLogP | 4.21 |
| TPSA | 177.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.40 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|