C25H20N4O2 — CID 135835485
2-hydroxy-4-methyl-5-(naphthalen-1-yldiazenyl)-6-oxo-1-(2-phenylethyl)pyridine-3-carbonitrile (PubChem CID 135835485) has the molecular formula C25H20N4O2 and a molecular weight of 408.46 g/mol. Its IUPAC name is 2-hydroxy-4-methyl-5-(naphthalen-1-yldiazenyl)-6-oxo-1-(2-phenylethyl)pyridine-3-carbonitrile.
| Compound Name | 2-hydroxy-4-methyl-5-(naphthalen-1-yldiazenyl)-6-oxo-1-(2-phenylethyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 135835485 |
| Molecular Formula | C25H20N4O2 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | 2-hydroxy-4-methyl-5-(naphthalen-1-yldiazenyl)-6-oxo-1-(2-phenylethyl)pyridine-3-carbonitrile |
| SMILES | Cc1c(C#N)c(O)n(CCc2ccccc2)c(=O)c1/N=N/c1cccc2ccccc12 |
| InChI | InChI=1S/C25H20N4O2/c1-17-21(16-26)24(30)29(15-14-18-8-3-2-4-9-18)25(31)23(17)28-27-22-13-7-11-19-10-5-6-12-20(19)22/h2-13,30H,14-15H2,1H3/b28-27+ |
| InChIKey | VLYLLBRELDXCQE-BYYHNAKLSA-N |
| XLogP | 5.55 |
| TPSA | 90.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|