C15H13BrN4O2 — CID 135835511
5-[(2-bromophenyl)diazenyl]-1-ethyl-2-hydroxy-4-methyl-6-oxopyridine-3-carbonitrile (PubChem CID 135835511) has the molecular formula C15H13BrN4O2 and a molecular weight of 361.20 g/mol. Its IUPAC name is 5-[(2-bromophenyl)diazenyl]-1-ethyl-2-hydroxy-4-methyl-6-oxopyridine-3-carbonitrile.
| Compound Name | 5-[(2-bromophenyl)diazenyl]-1-ethyl-2-hydroxy-4-methyl-6-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 135835511 |
| Molecular Formula | C15H13BrN4O2 |
| Molecular Weight | 361.20 g/mol |
| Exact Mass | 360.02 |
| IUPAC Name | 5-[(2-bromophenyl)diazenyl]-1-ethyl-2-hydroxy-4-methyl-6-oxopyridine-3-carbonitrile |
| SMILES | CCn1c(O)c(C#N)c(C)c(/N=N/c2ccccc2Br)c1=O |
| InChI | InChI=1S/C15H13BrN4O2/c1-3-20-14(21)10(8-17)9(2)13(15(20)22)19-18-12-7-5-4-6-11(12)16/h4-7,21H,3H2,1-2H3/b19-18+ |
| InChIKey | DKISFMIVSFBBDB-VHEBQXMUSA-N |
| XLogP | 3.93 |
| TPSA | 90.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.20 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|