C14H11FN4O2 — CID 135835423
5-[(4-fluorophenyl)diazenyl]-2-hydroxy-1,4-dimethyl-6-oxopyridine-3-carbonitrile (PubChem CID 135835423) has the molecular formula C14H11FN4O2 and a molecular weight of 286.27 g/mol. Its IUPAC name is 5-[(4-fluorophenyl)diazenyl]-2-hydroxy-1,4-dimethyl-6-oxopyridine-3-carbonitrile.
| Compound Name | 5-[(4-fluorophenyl)diazenyl]-2-hydroxy-1,4-dimethyl-6-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 135835423 |
| Molecular Formula | C14H11FN4O2 |
| Molecular Weight | 286.27 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | 5-[(4-fluorophenyl)diazenyl]-2-hydroxy-1,4-dimethyl-6-oxopyridine-3-carbonitrile |
| SMILES | Cc1c(C#N)c(O)n(C)c(=O)c1/N=N/c1ccc(F)cc1 |
| InChI | InChI=1S/C14H11FN4O2/c1-8-11(7-16)13(20)19(2)14(21)12(8)18-17-10-5-3-9(15)4-6-10/h3-6,20H,1-2H3/b18-17+ |
| InChIKey | PGHZZBLOFKKCGE-ISLYRVAYSA-N |
| XLogP | 2.83 |
| TPSA | 90.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.27 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|