C20H23N5O4 — CID 135835884
1-hexyl-2-hydroxy-4-methyl-5-[(2-methyl-5-nitrophenyl)diazenyl]-6-oxopyridine-3-carbonitrile (PubChem CID 135835884) has the molecular formula C20H23N5O4 and a molecular weight of 397.44 g/mol. Its IUPAC name is 1-hexyl-2-hydroxy-4-methyl-5-[(2-methyl-5-nitrophenyl)diazenyl]-6-oxopyridine-3-carbonitrile.
| Compound Name | 1-hexyl-2-hydroxy-4-methyl-5-[(2-methyl-5-nitrophenyl)diazenyl]-6-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 135835884 |
| Molecular Formula | C20H23N5O4 |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | 1-hexyl-2-hydroxy-4-methyl-5-[(2-methyl-5-nitrophenyl)diazenyl]-6-oxopyridine-3-carbonitrile |
| SMILES | CCCCCCn1c(O)c(C#N)c(C)c(/N=N/c2cc([N+](=O)[O-])ccc2C)c1=O |
| InChI | InChI=1S/C20H23N5O4/c1-4-5-6-7-10-24-19(26)16(12-21)14(3)18(20(24)27)23-22-17-11-15(25(28)29)9-8-13(17)2/h8-9,11,26H,4-7,10H2,1-3H3/b23-22+ |
| InChIKey | IRQPTOIKHSTXJZ-GHVJWSGMSA-N |
| XLogP | 4.95 |
| TPSA | 133.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|