C27H31N5O9 — CID 163918222
oxiran-2-ylmethyl 2-[[5-cyano-1-[2-(2-ethylhexanoyloxy)ethyl]-6-hydroxy-4-methyl-2-oxo-3-pyridinyl]diazenyl]-5-nitrobenzoate (PubChem CID 163918222) has the molecular formula C27H31N5O9 and a molecular weight of 569.57 g/mol. Its IUPAC name is oxiran-2-ylmethyl 2-[[5-cyano-1-[2-(2-ethylhexanoyloxy)ethyl]-6-hydroxy-4-methyl-2-oxo-3-pyridinyl]diazenyl]-5-nitrobenzoate.
| Compound Name | oxiran-2-ylmethyl 2-[[5-cyano-1-[2-(2-ethylhexanoyloxy)ethyl]-6-hydroxy-4-methyl-2-oxo-3-pyridinyl]diazenyl]-5-nitrobenzoate |
|---|---|
| PubChem CID | 163918222 |
| Molecular Formula | C27H31N5O9 |
| Molecular Weight | 569.57 g/mol |
| Exact Mass | 569.21 |
| IUPAC Name | oxiran-2-ylmethyl 2-[[5-cyano-1-[2-(2-ethylhexanoyloxy)ethyl]-6-hydroxy-4-methyl-2-oxo-3-pyridinyl]diazenyl]-5-nitrobenzoate |
| SMILES | CCCCC(CC)C(=O)OCCn1c(O)c(C#N)c(C)c(/N=N/c2ccc([N+](=O)[O-])cc2C(=O)OCC2CO2)c1=O |
| InChI | InChI=1S/C27H31N5O9/c1-4-6-7-17(5-2)26(35)39-11-10-31-24(33)21(13-28)16(3)23(25(31)34)30-29-22-9-8-18(32(37)38)12-20(22)27(36)41-15-19-14-40-19/h8-9,12,17,19,33H,4-7,10-11,14-15H2,1-3H3/b30-29+ |
| InChIKey | UOZRSLXZTSPZES-QVIHXGFCSA-N |
| XLogP | 4.37 |
| TPSA | 199.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.57 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|