C18H16F3N5O5 — CID 135835827
2-hydroxy-1-(3-methoxypropyl)-4-methyl-5-[[4-nitro-3-(trifluoromethyl)phenyl]diazenyl]-6-oxopyridine-3-carbonitrile (PubChem CID 135835827) has the molecular formula C18H16F3N5O5 and a molecular weight of 439.35 g/mol. Its IUPAC name is 2-hydroxy-1-(3-methoxypropyl)-4-methyl-5-[[4-nitro-3-(trifluoromethyl)phenyl]diazenyl]-6-oxopyridine-3-carbonitrile.
| Compound Name | 2-hydroxy-1-(3-methoxypropyl)-4-methyl-5-[[4-nitro-3-(trifluoromethyl)phenyl]diazenyl]-6-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 135835827 |
| Molecular Formula | C18H16F3N5O5 |
| Molecular Weight | 439.35 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | 2-hydroxy-1-(3-methoxypropyl)-4-methyl-5-[[4-nitro-3-(trifluoromethyl)phenyl]diazenyl]-6-oxopyridine-3-carbonitrile |
| SMILES | COCCCn1c(O)c(C#N)c(C)c(/N=N/c2ccc([N+](=O)[O-])c(C(F)(F)F)c2)c1=O |
| InChI | InChI=1S/C18H16F3N5O5/c1-10-12(9-22)16(27)25(6-3-7-31-2)17(28)15(10)24-23-11-4-5-14(26(29)30)13(8-11)18(19,20)21/h4-5,8,27H,3,6-7H2,1-2H3/b24-23+ |
| InChIKey | UIINEMMCWADVAJ-WCWDXBQESA-N |
| XLogP | 4.11 |
| TPSA | 143.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.35 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|