C22H16F3N5O4 — CID 135835834
2-hydroxy-4-methyl-5-[[4-nitro-3-(trifluoromethyl)phenyl]diazenyl]-6-oxo-1-(1-phenylethyl)pyridine-3-carbonitrile (PubChem CID 135835834) has the molecular formula C22H16F3N5O4 and a molecular weight of 471.40 g/mol. Its IUPAC name is 2-hydroxy-4-methyl-5-[[4-nitro-3-(trifluoromethyl)phenyl]diazenyl]-6-oxo-1-(1-phenylethyl)pyridine-3-carbonitrile.
| Compound Name | 2-hydroxy-4-methyl-5-[[4-nitro-3-(trifluoromethyl)phenyl]diazenyl]-6-oxo-1-(1-phenylethyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 135835834 |
| Molecular Formula | C22H16F3N5O4 |
| Molecular Weight | 471.40 g/mol |
| Exact Mass | 471.12 |
| IUPAC Name | 2-hydroxy-4-methyl-5-[[4-nitro-3-(trifluoromethyl)phenyl]diazenyl]-6-oxo-1-(1-phenylethyl)pyridine-3-carbonitrile |
| SMILES | Cc1c(C#N)c(O)n(C(C)c2ccccc2)c(=O)c1/N=N/c1ccc([N+](=O)[O-])c(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H16F3N5O4/c1-12-16(11-26)20(31)29(13(2)14-6-4-3-5-7-14)21(32)19(12)28-27-15-8-9-18(30(33)34)17(10-15)22(23,24)25/h3-10,13,31H,1-2H3/b28-27+ |
| InChIKey | NXRCOXRPWZIREW-BYYHNAKLSA-N |
| XLogP | 5.69 |
| TPSA | 133.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.40 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|