C19H22N4O3 — CID 135835072
5-[(3,4-dimethylphenyl)diazenyl]-2-hydroxy-1-(3-methoxypropyl)-4-methyl-6-oxopyridine-3-carbonitrile (PubChem CID 135835072) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is 5-[(3,4-dimethylphenyl)diazenyl]-2-hydroxy-1-(3-methoxypropyl)-4-methyl-6-oxopyridine-3-carbonitrile.
| Compound Name | 5-[(3,4-dimethylphenyl)diazenyl]-2-hydroxy-1-(3-methoxypropyl)-4-methyl-6-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 135835072 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 5-[(3,4-dimethylphenyl)diazenyl]-2-hydroxy-1-(3-methoxypropyl)-4-methyl-6-oxopyridine-3-carbonitrile |
| SMILES | COCCCn1c(O)c(C#N)c(C)c(/N=N/c2ccc(C)c(C)c2)c1=O |
| InChI | InChI=1S/C19H22N4O3/c1-12-6-7-15(10-13(12)2)21-22-17-14(3)16(11-20)18(24)23(19(17)25)8-5-9-26-4/h6-7,10,24H,5,8-9H2,1-4H3/b22-21+ |
| InChIKey | HOUQZFPZWASNEO-QURGRASLSA-N |
| XLogP | 3.80 |
| TPSA | 99.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|