C21H19N5O2 — CID 135835077
5-[(3,4-dimethylphenyl)diazenyl]-2-hydroxy-4-methyl-6-oxo-1-(pyridin-3-ylmethyl)pyridine-3-carbonitrile (PubChem CID 135835077) has the molecular formula C21H19N5O2 and a molecular weight of 373.42 g/mol. Its IUPAC name is 5-[(3,4-dimethylphenyl)diazenyl]-2-hydroxy-4-methyl-6-oxo-1-(pyridin-3-ylmethyl)pyridine-3-carbonitrile.
| Compound Name | 5-[(3,4-dimethylphenyl)diazenyl]-2-hydroxy-4-methyl-6-oxo-1-(pyridin-3-ylmethyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 135835077 |
| Molecular Formula | C21H19N5O2 |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 5-[(3,4-dimethylphenyl)diazenyl]-2-hydroxy-4-methyl-6-oxo-1-(pyridin-3-ylmethyl)pyridine-3-carbonitrile |
| SMILES | Cc1ccc(/N=N/c2c(C)c(C#N)c(O)n(Cc3cccnc3)c2=O)cc1C |
| InChI | InChI=1S/C21H19N5O2/c1-13-6-7-17(9-14(13)2)24-25-19-15(3)18(10-22)20(27)26(21(19)28)12-16-5-4-8-23-11-16/h4-9,11,27H,12H2,1-3H3/b25-24+ |
| InChIKey | MCZIHKAGSVHVOY-OCOZRVBESA-N |
| XLogP | 4.21 |
| TPSA | 103.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|