C18H13ClN4O3 — CID 135835056
5-[(3-chlorophenyl)diazenyl]-1-(furan-2-ylmethyl)-2-hydroxy-4-methyl-6-oxopyridine-3-carbonitrile (PubChem CID 135835056) has the molecular formula C18H13ClN4O3 and a molecular weight of 368.78 g/mol. Its IUPAC name is 5-[(3-chlorophenyl)diazenyl]-1-(furan-2-ylmethyl)-2-hydroxy-4-methyl-6-oxopyridine-3-carbonitrile.
| Compound Name | 5-[(3-chlorophenyl)diazenyl]-1-(furan-2-ylmethyl)-2-hydroxy-4-methyl-6-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 135835056 |
| Molecular Formula | C18H13ClN4O3 |
| Molecular Weight | 368.78 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | 5-[(3-chlorophenyl)diazenyl]-1-(furan-2-ylmethyl)-2-hydroxy-4-methyl-6-oxopyridine-3-carbonitrile |
| SMILES | Cc1c(C#N)c(O)n(Cc2ccco2)c(=O)c1/N=N/c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H13ClN4O3/c1-11-15(9-20)17(24)23(10-14-6-3-7-26-14)18(25)16(11)22-21-13-5-2-4-12(19)8-13/h2-8,24H,10H2,1H3/b22-21+ |
| InChIKey | JDHYGPHQJPOMIR-QURGRASLSA-N |
| XLogP | 4.44 |
| TPSA | 103.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.78 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|