C16H14N4O5 — CID 944396
3-[[5-cyano-6-hydroxy-1-(2-hydroxyethyl)-4-methyl-2-oxo-3-pyridinyl]diazenyl]benzoic acid (PubChem CID 944396) has the molecular formula C16H14N4O5 and a molecular weight of 342.31 g/mol. Its IUPAC name is 3-[[5-cyano-6-hydroxy-1-(2-hydroxyethyl)-4-methyl-2-oxo-3-pyridinyl]diazenyl]benzoic acid.
| Compound Name | 3-[[5-cyano-6-hydroxy-1-(2-hydroxyethyl)-4-methyl-2-oxo-3-pyridinyl]diazenyl]benzoic acid |
|---|---|
| PubChem CID | 944396 |
| Molecular Formula | C16H14N4O5 |
| Molecular Weight | 342.31 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 3-[[5-cyano-6-hydroxy-1-(2-hydroxyethyl)-4-methyl-2-oxo-3-pyridinyl]diazenyl]benzoic acid |
| SMILES | Cc1c(C#N)c(O)n(CCO)c(=O)c1/N=N/c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C16H14N4O5/c1-9-12(8-17)14(22)20(5-6-21)15(23)13(9)19-18-11-4-2-3-10(7-11)16(24)25/h2-4,7,21-22H,5-6H2,1H3,(H,24,25)/b19-18+ |
| InChIKey | JORMCKGHJHENRV-VHEBQXMUSA-N |
| XLogP | 1.84 |
| TPSA | 148.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.31 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|