C19H19ClN4O2 — CID 135835054
5-[(3-chlorophenyl)diazenyl]-1-cyclohexyl-2-hydroxy-4-methyl-6-oxopyridine-3-carbonitrile (PubChem CID 135835054) has the molecular formula C19H19ClN4O2 and a molecular weight of 370.84 g/mol. Its IUPAC name is 5-[(3-chlorophenyl)diazenyl]-1-cyclohexyl-2-hydroxy-4-methyl-6-oxopyridine-3-carbonitrile.
| Compound Name | 5-[(3-chlorophenyl)diazenyl]-1-cyclohexyl-2-hydroxy-4-methyl-6-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 135835054 |
| Molecular Formula | C19H19ClN4O2 |
| Molecular Weight | 370.84 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 5-[(3-chlorophenyl)diazenyl]-1-cyclohexyl-2-hydroxy-4-methyl-6-oxopyridine-3-carbonitrile |
| SMILES | Cc1c(C#N)c(O)n(C2CCCCC2)c(=O)c1/N=N/c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H19ClN4O2/c1-12-16(11-21)18(25)24(15-8-3-2-4-9-15)19(26)17(12)23-22-14-7-5-6-13(20)10-14/h5-7,10,15,25H,2-4,8-9H2,1H3/b23-22+ |
| InChIKey | YUCQFBQZKSLNEV-GHVJWSGMSA-N |
| XLogP | 5.31 |
| TPSA | 90.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.84 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|