C53H86N6O4 — CID 136992944
5-[(5-cyano-1-cyclohexyl-6-hydroxy-4-methyl-2-oxo-3-pyridinyl)diazenyl]-1-N,1-N,3-N,3-N-tetrakis(2-ethylhexyl)benzene-1,3-dicarboxamide (PubChem CID 136992944) has the molecular formula C53H86N6O4 and a molecular weight of 871.31 g/mol. Its IUPAC name is 5-[(5-cyano-1-cyclohexyl-6-hydroxy-4-methyl-2-oxo-3-pyridinyl)diazenyl]-1-N,1-N,3-N,3-N-tetrakis(2-ethylhexyl)benzene-1,3-dicarboxamide.
| Compound Name | 5-[(5-cyano-1-cyclohexyl-6-hydroxy-4-methyl-2-oxo-3-pyridinyl)diazenyl]-1-N,1-N,3-N,3-N-tetrakis(2-ethylhexyl)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 136992944 |
| Molecular Formula | C53H86N6O4 |
| Molecular Weight | 871.31 g/mol |
| Exact Mass | 870.67 |
| IUPAC Name | 5-[(5-cyano-1-cyclohexyl-6-hydroxy-4-methyl-2-oxo-3-pyridinyl)diazenyl]-1-N,1-N,3-N,3-N-tetrakis(2-ethylhexyl)benzene-1,3-dicarboxamide |
| SMILES | CCCCC(CC)CN(CC(CC)CCCC)C(=O)c1cc(/N=N/c2c(C)c(C#N)c(O)n(C3CCCCC3)c2=O)cc(C(=O)N(CC(CC)CCCC)CC(CC)CCCC)c1 |
| InChI | InChI=1S/C53H86N6O4/c1-10-18-25-40(14-5)35-57(36-41(15-6)26-19-11-2)50(60)44-31-45(51(61)58(37-42(16-7)27-20-12-3)38-43(17-8)28-21-13-4)33-46(32-44)55-56-49-39(9)48(34-54)52(62)59(53(49)63)47-29-23-22-24-30-47/h31-33,40-43,47,62H,10-30,35-38H2,1-9H3/b56-55+ |
| InChIKey | AJRPOPDCWFLHLV-WCNVQLFYSA-N |
| XLogP | 14.40 |
| TPSA | 131.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 871.31 |
| LogP ≤ 5 | 14.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|