C37H57N5O3 — CID 140899728
4-[(1,4-dibutyl-5-cyano-6-hydroxy-2-oxo-3-pyridinyl)diazenyl]-N,N-bis(2-ethylhexyl)benzamide (PubChem CID 140899728) has the molecular formula C37H57N5O3 and a molecular weight of 619.90 g/mol. Its IUPAC name is 4-[(1,4-dibutyl-5-cyano-6-hydroxy-2-oxo-3-pyridinyl)diazenyl]-N,N-bis(2-ethylhexyl)benzamide.
| Compound Name | 4-[(1,4-dibutyl-5-cyano-6-hydroxy-2-oxo-3-pyridinyl)diazenyl]-N,N-bis(2-ethylhexyl)benzamide |
|---|---|
| PubChem CID | 140899728 |
| Molecular Formula | C37H57N5O3 |
| Molecular Weight | 619.90 g/mol |
| Exact Mass | 619.45 |
| IUPAC Name | 4-[(1,4-dibutyl-5-cyano-6-hydroxy-2-oxo-3-pyridinyl)diazenyl]-N,N-bis(2-ethylhexyl)benzamide |
| SMILES | CCCCc1c(C#N)c(O)n(CCCC)c(=O)c1/N=N/c1ccc(C(=O)N(CC(CC)CCCC)CC(CC)CCCC)cc1 |
| InChI | InChI=1S/C37H57N5O3/c1-7-13-17-28(11-5)26-41(27-29(12-6)18-14-8-2)35(43)30-20-22-31(23-21-30)39-40-34-32(19-15-9-3)33(25-38)36(44)42(37(34)45)24-16-10-4/h20-23,28-29,44H,7-19,24,26-27H2,1-6H3/b40-39+ |
| InChIKey | DJMCPTCWRGLSAG-XQQUEIPISA-N |
| XLogP | 9.86 |
| TPSA | 111.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.90 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|