C34H47N5O — CID 118218095
2-[[4-[bis(2-ethylhexyl)amino]phenyl]diazenyl]-5-(2-methylpropanoyl)benzene-1,3-dicarbonitrile (PubChem CID 118218095) has the molecular formula C34H47N5O and a molecular weight of 541.78 g/mol. Its IUPAC name is 2-[[4-[bis(2-ethylhexyl)amino]phenyl]diazenyl]-5-(2-methylpropanoyl)benzene-1,3-dicarbonitrile.
| Compound Name | 2-[[4-[bis(2-ethylhexyl)amino]phenyl]diazenyl]-5-(2-methylpropanoyl)benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 118218095 |
| Molecular Formula | C34H47N5O |
| Molecular Weight | 541.78 g/mol |
| Exact Mass | 541.38 |
| IUPAC Name | 2-[[4-[bis(2-ethylhexyl)amino]phenyl]diazenyl]-5-(2-methylpropanoyl)benzene-1,3-dicarbonitrile |
| SMILES | CCCCC(CC)CN(CC(CC)CCCC)c1ccc(/N=N/c2c(C#N)cc(C(=O)C(C)C)cc2C#N)cc1 |
| InChI | InChI=1S/C34H47N5O/c1-7-11-13-26(9-3)23-39(24-27(10-4)14-12-8-2)32-17-15-31(16-18-32)37-38-33-29(21-35)19-28(20-30(33)22-36)34(40)25(5)6/h15-20,25-27H,7-14,23-24H2,1-6H3/b38-37+ |
| InChIKey | UXGDPVGBXXAFQC-HEFFKOSUSA-N |
| XLogP | 9.92 |
| TPSA | 92.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.78 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|