C38H55N5O — CID 118218110
2-[[4-[bis(2-ethylhexyl)amino]phenyl]diazenyl]-5-(2-ethylhexanoyl)benzene-1,3-dicarbonitrile (PubChem CID 118218110) has the molecular formula C38H55N5O and a molecular weight of 597.89 g/mol. Its IUPAC name is 2-[[4-[bis(2-ethylhexyl)amino]phenyl]diazenyl]-5-(2-ethylhexanoyl)benzene-1,3-dicarbonitrile.
| Compound Name | 2-[[4-[bis(2-ethylhexyl)amino]phenyl]diazenyl]-5-(2-ethylhexanoyl)benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 118218110 |
| Molecular Formula | C38H55N5O |
| Molecular Weight | 597.89 g/mol |
| Exact Mass | 597.44 |
| IUPAC Name | 2-[[4-[bis(2-ethylhexyl)amino]phenyl]diazenyl]-5-(2-ethylhexanoyl)benzene-1,3-dicarbonitrile |
| SMILES | CCCCC(CC)CN(CC(CC)CCCC)c1ccc(/N=N/c2c(C#N)cc(C(=O)C(CC)CCCC)cc2C#N)cc1 |
| InChI | InChI=1S/C38H55N5O/c1-7-13-16-29(10-4)27-43(28-30(11-5)17-14-8-2)36-21-19-35(20-22-36)41-42-37-33(25-39)23-32(24-34(37)26-40)38(44)31(12-6)18-15-9-3/h19-24,29-31H,7-18,27-28H2,1-6H3/b42-41+ |
| InChIKey | UXTHEWWQDIPUEE-WQVHNPAPSA-N |
| XLogP | 11.48 |
| TPSA | 92.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.89 |
| LogP ≤ 5 | 11.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|