C41H59N7O2S — CID 144635586
2-methylpropyl 4-[[5-[[4-[bis(2-ethylhexyl)amino]-5-methyl-2-(methylamino)phenyl]diazenyl]-4-cyano-3-methylthiophen-2-yl]diazenyl]benzoate (PubChem CID 144635586) has the molecular formula C41H59N7O2S and a molecular weight of 714.04 g/mol. Its IUPAC name is 2-methylpropyl 4-[[5-[[4-[bis(2-ethylhexyl)amino]-5-methyl-2-(methylamino)phenyl]diazenyl]-4-cyano-3-methylthiophen-2-yl]diazenyl]benzoate.
| Compound Name | 2-methylpropyl 4-[[5-[[4-[bis(2-ethylhexyl)amino]-5-methyl-2-(methylamino)phenyl]diazenyl]-4-cyano-3-methylthiophen-2-yl]diazenyl]benzoate |
|---|---|
| PubChem CID | 144635586 |
| Molecular Formula | C41H59N7O2S |
| Molecular Weight | 714.04 g/mol |
| Exact Mass | 713.45 |
| IUPAC Name | 2-methylpropyl 4-[[5-[[4-[bis(2-ethylhexyl)amino]-5-methyl-2-(methylamino)phenyl]diazenyl]-4-cyano-3-methylthiophen-2-yl]diazenyl]benzoate |
| SMILES | CCCCC(CC)CN(CC(CC)CCCC)c1cc(NC)c(/N=N/c2sc(/N=N/c3ccc(C(=O)OCC(C)C)cc3)c(C)c2C#N)cc1C |
| InChI | InChI=1S/C41H59N7O2S/c1-10-14-16-31(12-3)25-48(26-32(13-4)17-15-11-2)38-23-36(43-9)37(22-29(38)7)45-47-40-35(24-42)30(8)39(51-40)46-44-34-20-18-33(19-21-34)41(49)50-27-28(5)6/h18-23,28,31-32,43H,10-17,25-27H2,1-9H3/b46-44+,47-45+ |
| InChIKey | QCMLFWVIMLCCCI-NFAUJPPVSA-N |
| XLogP | 13.16 |
| TPSA | 114.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.04 |
| LogP ≤ 5 | 13.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|