C36H55N6O4P — CID 129048601
[2-[(2,4-dicyanophenyl)diazenyl]-4-(2-ethylhexoxy)-5-[2-ethylhexyl(hexyl)amino]anilino]phosphonic acid (PubChem CID 129048601) has the molecular formula C36H55N6O4P and a molecular weight of 666.85 g/mol. Its IUPAC name is [2-[(2,4-dicyanophenyl)diazenyl]-4-(2-ethylhexoxy)-5-[2-ethylhexyl(hexyl)amino]anilino]phosphonic acid.
| Compound Name | [2-[(2,4-dicyanophenyl)diazenyl]-4-(2-ethylhexoxy)-5-[2-ethylhexyl(hexyl)amino]anilino]phosphonic acid |
|---|---|
| PubChem CID | 129048601 |
| Molecular Formula | C36H55N6O4P |
| Molecular Weight | 666.85 g/mol |
| Exact Mass | 666.40 |
| IUPAC Name | [2-[(2,4-dicyanophenyl)diazenyl]-4-(2-ethylhexoxy)-5-[2-ethylhexyl(hexyl)amino]anilino]phosphonic acid |
| SMILES | CCCCCCN(CC(CC)CCCC)c1cc(NP(=O)(O)O)c(/N=N/c2ccc(C#N)cc2C#N)cc1OCC(CC)CCCC |
| InChI | InChI=1S/C36H55N6O4P/c1-6-11-14-15-20-42(26-28(9-4)16-12-7-2)35-22-34(41-47(43,44)45)33(23-36(35)46-27-29(10-5)17-13-8-3)40-39-32-19-18-30(24-37)21-31(32)25-38/h18-19,21-23,28-29H,6-17,20,26-27H2,1-5H3,(H3,41,43,44,45)/b40-39+ |
| InChIKey | DJXFDZVNDCQRDG-XQQUEIPISA-N |
| XLogP | 10.55 |
| TPSA | 154.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.85 |
| LogP ≤ 5 | 10.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|